C11H14N2O5 — CID 89488516
1-(2,3-dinitrophenyl)pentan-1-ol (PubChem CID 89488516) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 1-(2,3-dinitrophenyl)pentan-1-ol.
| Compound Name | 1-(2,3-dinitrophenyl)pentan-1-ol |
|---|---|
| PubChem CID | 89488516 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-(2,3-dinitrophenyl)pentan-1-ol |
| SMILES | CCCCC(O)c1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O5/c1-2-3-7-10(14)8-5-4-6-9(12(15)16)11(8)13(17)18/h4-6,10,14H,2-3,7H2,1H3 |
| InChIKey | JZPVFBHFEDYQAD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|