C8H9NOS — CID 55294351
(3S)-3-amino-2,3-dihydro-1-benzofuran-7-thiol (PubChem CID 55294351) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is (3S)-3-amino-2,3-dihydro-1-benzofuran-7-thiol.
| Compound Name | (3S)-3-amino-2,3-dihydro-1-benzofuran-7-thiol |
|---|---|
| PubChem CID | 55294351 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | (3S)-3-amino-2,3-dihydro-1-benzofuran-7-thiol |
| SMILES | N[C@@H]1COc2c(S)cccc21 |
| InChI | InChI=1S/C8H9NOS/c9-6-4-10-8-5(6)2-1-3-7(8)11/h1-3,6,11H,4,9H2/t6-/m1/s1 |
| InChIKey | HOWFFSFHWUJMAE-ZCFIWIBFSA-N |
| XLogP | 1.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|