C10H12INO — CID 130739663
(3S)-7-ethyl-6-iodo-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130739663) has the molecular formula C10H12INO and a molecular weight of 289.12 g/mol. Its IUPAC name is (3S)-7-ethyl-6-iodo-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3S)-7-ethyl-6-iodo-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 130739663 |
| Molecular Formula | C10H12INO |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (3S)-7-ethyl-6-iodo-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCc1c(I)ccc2c1OC[C@H]2N |
| InChI | InChI=1S/C10H12INO/c1-2-6-8(11)4-3-7-9(12)5-13-10(6)7/h3-4,9H,2,5,12H2,1H3/t9-/m1/s1 |
| InChIKey | KDQKIVWIUVISAT-SECBINFHSA-N |
| XLogP | 2.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|