C9H11NO2 — CID 130738460
(3S)-3-amino-7-methyl-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 130738460) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (3S)-3-amino-7-methyl-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | (3S)-3-amino-7-methyl-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 130738460 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (3S)-3-amino-7-methyl-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | Cc1c(O)ccc2c1OC[C@H]2N |
| InChI | InChI=1S/C9H11NO2/c1-5-8(11)3-2-6-7(10)4-12-9(5)6/h2-3,7,11H,4,10H2,1H3/t7-/m1/s1 |
| InChIKey | QBZSRLLYAVKOGX-SSDOTTSWSA-N |
| XLogP | 1.09 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |