C36H32N4O14 — CID 10865524
3,9,23,29-tetranitro-13,16,19,33,36,39-hexaoxaheptacyclo[29.9.1.111,21.05,40.07,12.020,25.027,32]dotetraconta-1,3,5(40),7(12),8,10,20(25),21,23,27(32),28,30-dodecaene (PubChem CID 10865524) has the molecular formula C36H32N4O14 and a molecular weight of 744.67 g/mol. Its IUPAC name is 3,9,23,29-tetranitro-13,16,19,33,36,39-hexaoxaheptacyclo[29.9.1.111,21.05,40.07,12.020,25.027,32]dotetraconta-1,3,5(40),7(12),8,10,20(25),21,23,27(32),28,30-dodecaene.
| Compound Name | 3,9,23,29-tetranitro-13,16,19,33,36,39-hexaoxaheptacyclo[29.9.1.111,21.05,40.07,12.020,25.027,32]dotetraconta-1,3,5(40),7(12),8,10,20(25),21,23,27(32),28,30-dodecaene |
|---|---|
| PubChem CID | 10865524 |
| Molecular Formula | C36H32N4O14 |
| Molecular Weight | 744.67 g/mol |
| Exact Mass | 744.19 |
| IUPAC Name | 3,9,23,29-tetranitro-13,16,19,33,36,39-hexaoxaheptacyclo[29.9.1.111,21.05,40.07,12.020,25.027,32]dotetraconta-1,3,5(40),7(12),8,10,20(25),21,23,27(32),28,30-dodecaene |
| SMILES | O=[N+]([O-])c1cc2c3c(c1)Cc1cc([N+](=O)[O-])cc4c1OCCOCCOc1c(cc([N+](=O)[O-])cc1Cc1cc([N+](=O)[O-])cc(c1OCCOCCO3)C2)C4 |
| InChI | InChI=1S/C36H32N4O14/c41-37(42)29-13-21-9-22-14-30(38(43)44)19-27-12-28-20-32(40(47)48)16-24-10-23-15-31(39(45)46)18-26(35(23)53-7-3-50-4-8-54-36(24)28)11-25(17-29)33(21)51-5-1-49-2-6-52-34(22)27/h13-20H,1-12H2 |
| InChIKey | DIAIHHFMUCACHN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 227.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|