C9H9BrN2O — CID 168529950
(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine (PubChem CID 168529950) has the molecular formula C9H9BrN2O and a molecular weight of 241.09 g/mol. Its IUPAC name is (7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine.
| Compound Name | (7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine |
|---|---|
| PubChem CID | 168529950 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | (7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylidenehydrazine |
| SMILES | NN=Cc1cc(Br)c2c(c1)CCO2 |
| InChI | InChI=1S/C9H9BrN2O/c10-8-4-6(5-12-11)3-7-1-2-13-9(7)8/h3-5H,1-2,11H2 |
| InChIKey | KUHYMFMRGDVVJJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|