C10H12BrNO2 — CID 83901569
2-amino-2-(7-bromo-2,3-dihydro-1-benzofuran-5-yl)ethanol (PubChem CID 83901569) has the molecular formula C10H12BrNO2 and a molecular weight of 258.12 g/mol. Its IUPAC name is 2-amino-2-(7-bromo-2,3-dihydro-1-benzofuran-5-yl)ethanol.
| Compound Name | 2-amino-2-(7-bromo-2,3-dihydro-1-benzofuran-5-yl)ethanol |
|---|---|
| PubChem CID | 83901569 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-amino-2-(7-bromo-2,3-dihydro-1-benzofuran-5-yl)ethanol |
| SMILES | NC(CO)c1cc(Br)c2c(c1)CCO2 |
| InChI | InChI=1S/C10H12BrNO2/c11-8-4-7(9(12)5-13)3-6-1-2-14-10(6)8/h3-4,9,13H,1-2,5,12H2 |
| InChIKey | OPHPMZBPUPLHIS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |