C10H10BrN3OS — CID 168535061
[(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]thiourea (PubChem CID 168535061) has the molecular formula C10H10BrN3OS and a molecular weight of 300.18 g/mol. Its IUPAC name is [(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]thiourea.
| Compound Name | [(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535061 |
| Molecular Formula | C10H10BrN3OS |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | [(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(Br)c2c(c1)CCO2 |
| InChI | InChI=1S/C10H10BrN3OS/c11-8-4-6(5-13-14-10(12)16)3-7-1-2-15-9(7)8/h3-5H,1-2H2,(H3,12,14,16) |
| InChIKey | XWMIXLSYQBZFKX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|