C21H27NO3 — CID 142005929
13,14,15-trimethoxy-N-propyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-5-amine (PubChem CID 142005929) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 13,14,15-trimethoxy-N-propyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-5-amine.
| Compound Name | 13,14,15-trimethoxy-N-propyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-5-amine |
|---|---|
| PubChem CID | 142005929 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 13,14,15-trimethoxy-N-propyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-5-amine |
| SMILES | CCCNc1ccc2c(c1)CCCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C21H27NO3/c1-5-11-22-16-9-10-17-14(12-16)7-6-8-15-13-18(23-2)20(24-3)21(25-4)19(15)17/h9-10,12-13,22H,5-8,11H2,1-4H3 |
| InChIKey | DUDMSBGNNDYIDD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |