C9H8INO2 — CID 142057462
5-iodo-6,7-dihydro-[1,3]dioxolo[4,5-f]indole (PubChem CID 142057462) has the molecular formula C9H8INO2 and a molecular weight of 289.07 g/mol. Its IUPAC name is 5-iodo-6,7-dihydro-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 5-iodo-6,7-dihydro-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 142057462 |
| Molecular Formula | C9H8INO2 |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 5-iodo-6,7-dihydro-[1,3]dioxolo[4,5-f]indole |
| SMILES | IN1CCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C9H8INO2/c10-11-2-1-6-3-8-9(4-7(6)11)13-5-12-8/h3-4H,1-2,5H2 |
| InChIKey | VDGATLSOXCMPFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|