C10H11NO4 — CID 135083959
4,7-dimethoxy-1,4-benzoxazin-3-one (PubChem CID 135083959) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4,7-dimethoxy-1,4-benzoxazin-3-one.
| Compound Name | 4,7-dimethoxy-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135083959 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 4,7-dimethoxy-1,4-benzoxazin-3-one |
| SMILES | COc1ccc2c(c1)OCC(=O)N2OC |
| InChI | InChI=1S/C10H11NO4/c1-13-7-3-4-8-9(5-7)15-6-10(12)11(8)14-2/h3-5H,6H2,1-2H3 |
| InChIKey | YCPSKYCKGPHXMA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |