C15H11NO4 — CID 102098309
6-methoxy-[1,3]dioxolo[4,5-b]phenanthridin-5-one (PubChem CID 102098309) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 6-methoxy-[1,3]dioxolo[4,5-b]phenanthridin-5-one.
| Compound Name | 6-methoxy-[1,3]dioxolo[4,5-b]phenanthridin-5-one |
|---|---|
| PubChem CID | 102098309 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 6-methoxy-[1,3]dioxolo[4,5-b]phenanthridin-5-one |
| SMILES | COn1c(=O)c2ccccc2c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C15H11NO4/c1-18-16-12-7-14-13(19-8-20-14)6-11(12)9-4-2-3-5-10(9)15(16)17/h2-7H,8H2,1H3 |
| InChIKey | KXUNCBQEKKARGQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|