C20H15NO5 — CID 11035465
5-(4-methoxyphenyl)-8-methyl-4,12,14-trioxa-8-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),5,9,11(15)-pentaen-3-one (PubChem CID 11035465) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-8-methyl-4,12,14-trioxa-8-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),5,9,11(15)-pentaen-3-one.
| Compound Name | 5-(4-methoxyphenyl)-8-methyl-4,12,14-trioxa-8-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),5,9,11(15)-pentaen-3-one |
|---|---|
| PubChem CID | 11035465 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-(4-methoxyphenyl)-8-methyl-4,12,14-trioxa-8-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),5,9,11(15)-pentaen-3-one |
| SMILES | COc1ccc(-c2cc3c(c(=O)o2)c2cc4c(cc2n3C)OCO4)cc1 |
| InChI | InChI=1S/C20H15NO5/c1-21-14-8-18-17(24-10-25-18)7-13(14)19-15(21)9-16(26-20(19)22)11-3-5-12(23-2)6-4-11/h3-9H,10H2,1-2H3 |
| InChIKey | UMSBFGOHODZFMD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |