C27H21NO5 — CID 102238774
2-methoxy-13-(4-methoxyphenyl)-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one (PubChem CID 102238774) has the molecular formula C27H21NO5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-methoxy-13-(4-methoxyphenyl)-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one.
| Compound Name | 2-methoxy-13-(4-methoxyphenyl)-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one |
|---|---|
| PubChem CID | 102238774 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-methoxy-13-(4-methoxyphenyl)-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-1-one |
| SMILES | COc1ccc(-c2c3c(=O)c(OC)ccc-3c3ccc4cc5c(cc4c3n2C)OCO5)cc1 |
| InChI | InChI=1S/C27H21NO5/c1-28-25(15-4-7-17(30-2)8-5-15)24-18(10-11-21(31-3)27(24)29)19-9-6-16-12-22-23(33-14-32-22)13-20(16)26(19)28/h4-13H,14H2,1-3H3 |
| InChIKey | GVMUMUFKBRIFFY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|