C39H30O4 — CID 156516466
6-[(Z)-2-(4-methoxyphenyl)ethenyl]-20-[(E)-2-(4-methoxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene (PubChem CID 156516466) has the molecular formula C39H30O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is 6-[(Z)-2-(4-methoxyphenyl)ethenyl]-20-[(E)-2-(4-methoxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene.
| Compound Name | 6-[(Z)-2-(4-methoxyphenyl)ethenyl]-20-[(E)-2-(4-methoxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene |
|---|---|
| PubChem CID | 156516466 |
| Molecular Formula | C39H30O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 6-[(Z)-2-(4-methoxyphenyl)ethenyl]-20-[(E)-2-(4-methoxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene |
| SMILES | COc1ccc(/C=C\c2ccc3c4c(ccc3c2)OCOc2ccc3cc(/C=C/c5ccc(OC)cc5)ccc3c2-4)cc1 |
| InChI | InChI=1S/C39H30O4/c1-40-32-15-7-26(8-16-32)3-5-28-11-19-34-30(23-28)13-21-36-38(34)39-35-20-12-29(6-4-27-9-17-33(41-2)18-10-27)24-31(35)14-22-37(39)43-25-42-36/h3-24H,25H2,1-2H3/b5-3-,6-4+ |
| InChIKey | XWKNZBVORRWGIQ-CIIODKQPSA-N |
| XLogP | 9.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|