C18H13ClN2O3 — CID 139921647
2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-chloro-7-methoxyquinazoline (PubChem CID 139921647) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-chloro-7-methoxyquinazoline.
| Compound Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-chloro-7-methoxyquinazoline |
|---|---|
| PubChem CID | 139921647 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-chloro-7-methoxyquinazoline |
| SMILES | COc1ccc2c(Cl)nc(/C=C/c3ccc4c(c3)OCO4)nc2c1 |
| InChI | InChI=1S/C18H13ClN2O3/c1-22-12-4-5-13-14(9-12)20-17(21-18(13)19)7-3-11-2-6-15-16(8-11)24-10-23-15/h2-9H,10H2,1H3/b7-3+ |
| InChIKey | FMPJEKUOFSQRHC-XVNBXDOJSA-N |
| XLogP | 4.19 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |