C18H11Cl2NO3 — CID 3459413
2-[2-(1,3-benzodioxol-5-yl)ethenyl]-5,7-dichloroquinolin-8-ol (PubChem CID 3459413) has the molecular formula C18H11Cl2NO3 and a molecular weight of 360.20 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethenyl]-5,7-dichloroquinolin-8-ol.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]-5,7-dichloroquinolin-8-ol |
|---|---|
| PubChem CID | 3459413 |
| Molecular Formula | C18H11Cl2NO3 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]-5,7-dichloroquinolin-8-ol |
| SMILES | Oc1c(Cl)cc(Cl)c2ccc(C=Cc3ccc4c(c3)OCO4)nc12 |
| InChI | InChI=1S/C18H11Cl2NO3/c19-13-8-14(20)18(22)17-12(13)5-4-11(21-17)3-1-10-2-6-15-16(7-10)24-9-23-15/h1-8,22H,9H2 |
| InChIKey | SSLATJAKRCCSGL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |