C18H13Cl2NO2 — CID 6187033
5,7-dichloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinolin-8-ol (PubChem CID 6187033) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 5,7-dichloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinolin-8-ol.
| Compound Name | 5,7-dichloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 6187033 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 5,7-dichloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinolin-8-ol |
| SMILES | COc1ccc(/C=C/c2ccc3c(Cl)cc(Cl)c(O)c3n2)cc1 |
| InChI | InChI=1S/C18H13Cl2NO2/c1-23-13-7-3-11(4-8-13)2-5-12-6-9-14-15(19)10-16(20)18(22)17(14)21-12/h2-10,22H,1H3/b5-2+ |
| InChIKey | DXLATMMDHMQPDG-GORDUTHDSA-N |
| XLogP | 5.43 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |