C18H15ClN2O3S — CID 18344982
5-chloro-8-hydroxy-N-methyl-2-[(E)-2-phenylethenyl]quinoline-7-sulfonamide (PubChem CID 18344982) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is 5-chloro-8-hydroxy-N-methyl-2-[(E)-2-phenylethenyl]quinoline-7-sulfonamide.
| Compound Name | 5-chloro-8-hydroxy-N-methyl-2-[(E)-2-phenylethenyl]quinoline-7-sulfonamide |
|---|---|
| PubChem CID | 18344982 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 5-chloro-8-hydroxy-N-methyl-2-[(E)-2-phenylethenyl]quinoline-7-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(Cl)c2ccc(/C=C/c3ccccc3)nc2c1O |
| InChI | InChI=1S/C18H15ClN2O3S/c1-20-25(23,24)16-11-15(19)14-10-9-13(21-17(14)18(16)22)8-7-12-5-3-2-4-6-12/h2-11,20,22H,1H3/b8-7+ |
| InChIKey | WGSAKPDOWFOAGK-BQYQJAHWSA-N |
| XLogP | 3.67 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |