C21H13Cl2NO — CID 7946493
5,7-dichloro-2-[(E)-2-naphthalen-2-ylethenyl]quinolin-8-ol (PubChem CID 7946493) has the molecular formula C21H13Cl2NO and a molecular weight of 366.25 g/mol. Its IUPAC name is 5,7-dichloro-2-[(E)-2-naphthalen-2-ylethenyl]quinolin-8-ol.
| Compound Name | 5,7-dichloro-2-[(E)-2-naphthalen-2-ylethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7946493 |
| Molecular Formula | C21H13Cl2NO |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 5,7-dichloro-2-[(E)-2-naphthalen-2-ylethenyl]quinolin-8-ol |
| SMILES | Oc1c(Cl)cc(Cl)c2ccc(/C=C/c3ccc4ccccc4c3)nc12 |
| InChI | InChI=1S/C21H13Cl2NO/c22-18-12-19(23)21(25)20-17(18)10-9-16(24-20)8-6-13-5-7-14-3-1-2-4-15(14)11-13/h1-12,25H/b8-6+ |
| InChIKey | UDKGRTDMGIAUGD-SOFGYWHQSA-N |
| XLogP | 6.57 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |