C19H15Cl2NO2 — CID 71450723
5,7-dichloro-2-[(E)-2-(4-ethoxyphenyl)ethenyl]quinolin-8-ol (PubChem CID 71450723) has the molecular formula C19H15Cl2NO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is 5,7-dichloro-2-[(E)-2-(4-ethoxyphenyl)ethenyl]quinolin-8-ol.
| Compound Name | 5,7-dichloro-2-[(E)-2-(4-ethoxyphenyl)ethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 71450723 |
| Molecular Formula | C19H15Cl2NO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 5,7-dichloro-2-[(E)-2-(4-ethoxyphenyl)ethenyl]quinolin-8-ol |
| SMILES | CCOc1ccc(/C=C/c2ccc3c(Cl)cc(Cl)c(O)c3n2)cc1 |
| InChI | InChI=1S/C19H15Cl2NO2/c1-2-24-14-8-4-12(5-9-14)3-6-13-7-10-15-16(20)11-17(21)19(23)18(15)22-13/h3-11,23H,2H2,1H3/b6-3+ |
| InChIKey | KUZNJQDCWIJYLD-ZZXKWVIFSA-N |
| XLogP | 5.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |