C19H15Cl2NO — CID 7946483
5,7-dichloro-2-[(E)-2-(4-ethylphenyl)ethenyl]quinolin-8-ol (PubChem CID 7946483) has the molecular formula C19H15Cl2NO and a molecular weight of 344.24 g/mol. Its IUPAC name is 5,7-dichloro-2-[(E)-2-(4-ethylphenyl)ethenyl]quinolin-8-ol.
| Compound Name | 5,7-dichloro-2-[(E)-2-(4-ethylphenyl)ethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7946483 |
| Molecular Formula | C19H15Cl2NO |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 5,7-dichloro-2-[(E)-2-(4-ethylphenyl)ethenyl]quinolin-8-ol |
| SMILES | CCc1ccc(/C=C/c2ccc3c(Cl)cc(Cl)c(O)c3n2)cc1 |
| InChI | InChI=1S/C19H15Cl2NO/c1-2-12-3-5-13(6-4-12)7-8-14-9-10-15-16(20)11-17(21)19(23)18(15)22-14/h3-11,23H,2H2,1H3/b8-7+ |
| InChIKey | KMTRHCROXFGPSB-BQYQJAHWSA-N |
| XLogP | 5.98 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |