C18H11Cl2NO3 — CID 3314466
4-[2-(5,7-dichloro-8-hydroxyquinolin-2-yl)ethenyl]benzoic acid (PubChem CID 3314466) has the molecular formula C18H11Cl2NO3 and a molecular weight of 360.20 g/mol. Its IUPAC name is 4-[2-(5,7-dichloro-8-hydroxyquinolin-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-[2-(5,7-dichloro-8-hydroxyquinolin-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 3314466 |
| Molecular Formula | C18H11Cl2NO3 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 4-[2-(5,7-dichloro-8-hydroxyquinolin-2-yl)ethenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=Cc2ccc3c(Cl)cc(Cl)c(O)c3n2)cc1 |
| InChI | InChI=1S/C18H11Cl2NO3/c19-14-9-15(20)17(22)16-13(14)8-7-12(21-16)6-3-10-1-4-11(5-2-10)18(23)24/h1-9,22H,(H,23,24) |
| InChIKey | GCIXRJJXHZPDFP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |