C20H15NO8 — CID 136612305
2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethenyl]-8-hydroxyquinoline-5,7-dicarboxylic acid (PubChem CID 136612305) has the molecular formula C20H15NO8 and a molecular weight of 397.34 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethenyl]-8-hydroxyquinoline-5,7-dicarboxylic acid.
| Compound Name | 2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethenyl]-8-hydroxyquinoline-5,7-dicarboxylic acid |
|---|---|
| PubChem CID | 136612305 |
| Molecular Formula | C20H15NO8 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-[2-(3,4-dihydroxy-5-methoxyphenyl)ethenyl]-8-hydroxyquinoline-5,7-dicarboxylic acid |
| SMILES | COc1cc(C=Cc2ccc3c(C(=O)O)cc(C(=O)O)c(O)c3n2)cc(O)c1O |
| InChI | InChI=1S/C20H15NO8/c1-29-15-7-9(6-14(22)18(15)24)2-3-10-4-5-11-12(19(25)26)8-13(20(27)28)17(23)16(11)21-10/h2-8,22-24H,1H3,(H,25,26)(H,27,28) |
| InChIKey | JQFJAHFUUQQPMR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|