C17H14Cl2N2O3S — CID 10453395
5-chloro-N-[(4-chlorophenyl)methyl]-8-hydroxy-2-methylquinoline-7-sulfonamide (PubChem CID 10453395) has the molecular formula C17H14Cl2N2O3S and a molecular weight of 397.28 g/mol. Its IUPAC name is 5-chloro-N-[(4-chlorophenyl)methyl]-8-hydroxy-2-methylquinoline-7-sulfonamide.
| Compound Name | 5-chloro-N-[(4-chlorophenyl)methyl]-8-hydroxy-2-methylquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 10453395 |
| Molecular Formula | C17H14Cl2N2O3S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 5-chloro-N-[(4-chlorophenyl)methyl]-8-hydroxy-2-methylquinoline-7-sulfonamide |
| SMILES | Cc1ccc2c(Cl)cc(S(=O)(=O)NCc3ccc(Cl)cc3)c(O)c2n1 |
| InChI | InChI=1S/C17H14Cl2N2O3S/c1-10-2-7-13-14(19)8-15(17(22)16(13)21-10)25(23,24)20-9-11-3-5-12(18)6-4-11/h2-8,20,22H,9H2,1H3 |
| InChIKey | CVOUEVVZTAXTAC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |