C18H13NO3 — CID 2896089
2-[2-(1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol (PubChem CID 2896089) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 2896089 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol |
| SMILES | Oc1cccc2ccc(C=Cc3ccc4c(c3)OCO4)nc12 |
| InChI | InChI=1S/C18H13NO3/c20-15-3-1-2-13-6-8-14(19-18(13)15)7-4-12-5-9-16-17(10-12)22-11-21-16/h1-10,20H,11H2 |
| InChIKey | JBRXQRJDXQJFIS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |