C49H32Br2O2 — CID 159867883
6,20-bis[(E)-2-bromo-2-(4-phenylphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene (PubChem CID 159867883) has the molecular formula C49H32Br2O2 and a molecular weight of 812.60 g/mol. Its IUPAC name is 6,20-bis[(E)-2-bromo-2-(4-phenylphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene.
| Compound Name | 6,20-bis[(E)-2-bromo-2-(4-phenylphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene |
|---|---|
| PubChem CID | 159867883 |
| Molecular Formula | C49H32Br2O2 |
| Molecular Weight | 812.60 g/mol |
| Exact Mass | 810.08 |
| IUPAC Name | 6,20-bis[(E)-2-bromo-2-(4-phenylphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaene |
| SMILES | Br/C(=C/c1ccc2c3c(ccc2c1)OCOc1ccc2cc(/C=C(/Br)c4ccc(-c5ccccc5)cc4)ccc2c1-3)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C49H32Br2O2/c50-44(38-17-13-36(14-18-38)34-7-3-1-4-8-34)29-32-11-23-42-40(27-32)21-25-46-48(42)49-43-24-12-33(28-41(43)22-26-47(49)53-31-52-46)30-45(51)39-19-15-37(16-20-39)35-9-5-2-6-10-35/h1-30H,31H2/b44-29+,45-30+ |
| InChIKey | DXAHQWLRTGNHDZ-DNBAPOOWSA-N |
| XLogP | 14.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.60 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|