C25H19NO5 — CID 18592568
7-benzoyl-5-[(4-methoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]quinolin-8-one (PubChem CID 18592568) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is 7-benzoyl-5-[(4-methoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]quinolin-8-one.
| Compound Name | 7-benzoyl-5-[(4-methoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]quinolin-8-one |
|---|---|
| PubChem CID | 18592568 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 7-benzoyl-5-[(4-methoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]quinolin-8-one |
| SMILES | COc1ccc(Cn2cc(C(=O)c3ccccc3)c(=O)c3cc4c(cc32)OCO4)cc1 |
| InChI | InChI=1S/C25H19NO5/c1-29-18-9-7-16(8-10-18)13-26-14-20(24(27)17-5-3-2-4-6-17)25(28)19-11-22-23(12-21(19)26)31-15-30-22/h2-12,14H,13,15H2,1H3 |
| InChIKey | CHISGMOZQIOITN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |