C25H19NO4 — CID 20864529
3-(1,3-benzodioxole-5-carbonyl)-1-benzyl-6-methylquinolin-4-one (PubChem CID 20864529) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxole-5-carbonyl)-1-benzyl-6-methylquinolin-4-one.
| Compound Name | 3-(1,3-benzodioxole-5-carbonyl)-1-benzyl-6-methylquinolin-4-one |
|---|---|
| PubChem CID | 20864529 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-(1,3-benzodioxole-5-carbonyl)-1-benzyl-6-methylquinolin-4-one |
| SMILES | Cc1ccc2c(c1)c(=O)c(C(=O)c1ccc3c(c1)OCO3)cn2Cc1ccccc1 |
| InChI | InChI=1S/C25H19NO4/c1-16-7-9-21-19(11-16)25(28)20(14-26(21)13-17-5-3-2-4-6-17)24(27)18-8-10-22-23(12-18)30-15-29-22/h2-12,14H,13,15H2,1H3 |
| InChIKey | XXSGPBJKYWIBRI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |