C26H23NO4 — CID 2136065
6-methoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one (PubChem CID 2136065) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is 6-methoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one.
| Compound Name | 6-methoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one |
|---|---|
| PubChem CID | 2136065 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6-methoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one |
| SMILES | COc1cccc(Cn2cc(C(=O)c3ccc(C)cc3)c(=O)c3cc(OC)ccc32)c1 |
| InChI | InChI=1S/C26H23NO4/c1-17-7-9-19(10-8-17)25(28)23-16-27(15-18-5-4-6-20(13-18)30-2)24-12-11-21(31-3)14-22(24)26(23)29/h4-14,16H,15H2,1-3H3 |
| InChIKey | BNMNLQVJFVABEV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |