C25H20FNO3 — CID 2136066
6-fluoro-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one (PubChem CID 2136066) has the molecular formula C25H20FNO3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 6-fluoro-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one.
| Compound Name | 6-fluoro-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one |
|---|---|
| PubChem CID | 2136066 |
| Molecular Formula | C25H20FNO3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 6-fluoro-1-[(3-methoxyphenyl)methyl]-3-(4-methylbenzoyl)quinolin-4-one |
| SMILES | COc1cccc(Cn2cc(C(=O)c3ccc(C)cc3)c(=O)c3cc(F)ccc32)c1 |
| InChI | InChI=1S/C25H20FNO3/c1-16-6-8-18(9-7-16)24(28)22-15-27(14-17-4-3-5-20(12-17)30-2)23-11-10-19(26)13-21(23)25(22)29/h3-13,15H,14H2,1-2H3 |
| InChIKey | HCQAJRGZLCQBEY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |