(3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid

C9H8O4 — CID 124707891

IUPAC(3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)[C@@H](O)CO2
InChIInChI=1S/C9H8O4/c10-7-4-13-8-2-1-5(9(11)12)3-6(7)8/h1-3,7,10H,4H2,(H,11,12)/t7-/m0/s1
InChIKeyWPJOUHBHNOSJMG-ZETCQYMHSA-N
MW180.16 g/mol
LogP0.81
Rot. Bonds1

About (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid

(3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid (PubChem CID 124707891) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid.

Molecular Properties

Compound Name(3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid
PubChem CID124707891
Molecular FormulaC9H8O4
Molecular Weight180.16 g/mol
Exact Mass180.04
IUPAC Name(3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)[C@@H](O)CO2
InChIInChI=1S/C9H8O4/c10-7-4-13-8-2-1-5(9(11)12)3-6(7)8/h1-3,7,10H,4H2,(H,11,12)/t7-/m0/s1
InChIKeyWPJOUHBHNOSJMG-ZETCQYMHSA-N
XLogP0.81
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.16
LogP ≤ 50.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid?
The IUPAC name of (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid (CID 124707891) is (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid.
What is the SMILES notation for (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid?
The canonical SMILES for (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid is O=C(O)c1ccc2c(c1)[C@@H](O)CO2.
What is the InChIKey of (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid?
The InChIKey is WPJOUHBHNOSJMG-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H8O4/c10-7-4-13-8-2-1-5(9(11)12)3-6(7)8/h1-3,7,10H,4H2,(H,11,12)/t7-/m0/s1.
What are the key properties of (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid?
(3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-2,3-dihydro-1-benzofuran-5-carboxylic acid is sourced from PubChem (CID 124707891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).