C17H14O3 — CID 23533004
2-methylidene-4-phenyl-3,4-dihydrochromene-6-carboxylic acid (PubChem CID 23533004) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-methylidene-4-phenyl-3,4-dihydrochromene-6-carboxylic acid.
| Compound Name | 2-methylidene-4-phenyl-3,4-dihydrochromene-6-carboxylic acid |
|---|---|
| PubChem CID | 23533004 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-methylidene-4-phenyl-3,4-dihydrochromene-6-carboxylic acid |
| SMILES | C=C1CC(c2ccccc2)c2cc(C(=O)O)ccc2O1 |
| InChI | InChI=1S/C17H14O3/c1-11-9-14(12-5-3-2-4-6-12)15-10-13(17(18)19)7-8-16(15)20-11/h2-8,10,14H,1,9H2,(H,18,19) |
| InChIKey | CNOZSGTULRMLIZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |