C33H32O6 — CID 158898022
(4R)-6-acetyl-4-phenyl-3,4-dihydrochromen-2-one;4-(hydroxymethyl)-2-[(1R)-3-hydroxy-1-phenylpropyl]phenol (PubChem CID 158898022) has the molecular formula C33H32O6 and a molecular weight of 524.61 g/mol. Its IUPAC name is (4R)-6-acetyl-4-phenyl-3,4-dihydrochromen-2-one;4-(hydroxymethyl)-2-[(1R)-3-hydroxy-1-phenylpropyl]phenol.
| Compound Name | (4R)-6-acetyl-4-phenyl-3,4-dihydrochromen-2-one;4-(hydroxymethyl)-2-[(1R)-3-hydroxy-1-phenylpropyl]phenol |
|---|---|
| PubChem CID | 158898022 |
| Molecular Formula | C33H32O6 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (4R)-6-acetyl-4-phenyl-3,4-dihydrochromen-2-one;4-(hydroxymethyl)-2-[(1R)-3-hydroxy-1-phenylpropyl]phenol |
| SMILES | CC(=O)c1ccc2c(c1)[C@@H](c1ccccc1)CC(=O)O2.OCC[C@H](c1ccccc1)c1cc(CO)ccc1O |
| InChI | InChI=1S/C17H14O3.C16H18O3/c1-11(18)13-7-8-16-15(9-13)14(10-17(19)20-16)12-5-3-2-4-6-12;17-9-8-14(13-4-2-1-3-5-13)15-10-12(11-18)6-7-16(15)19/h2-9,14H,10H2,1H3;1-7,10,14,17-19H,8-9,11H2/t2*14-/m11/s1 |
| InChIKey | JFBUFCFZQOMNCP-RPERETBRSA-N |
| XLogP | 5.73 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|