C17H14O4 — CID 99991049
(4R)-6-acetyl-5-hydroxy-4-phenyl-3,4-dihydrochromen-2-one (PubChem CID 99991049) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (4R)-6-acetyl-5-hydroxy-4-phenyl-3,4-dihydrochromen-2-one.
| Compound Name | (4R)-6-acetyl-5-hydroxy-4-phenyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 99991049 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (4R)-6-acetyl-5-hydroxy-4-phenyl-3,4-dihydrochromen-2-one |
| SMILES | CC(=O)c1ccc2c(c1O)[C@@H](c1ccccc1)CC(=O)O2 |
| InChI | InChI=1S/C17H14O4/c1-10(18)12-7-8-14-16(17(12)20)13(9-15(19)21-14)11-5-3-2-4-6-11/h2-8,13,20H,9H2,1H3/t13-/m1/s1 |
| InChIKey | HIUTUMGESXTECA-CYBMUJFWSA-N |
| XLogP | 3.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|