C24H17ClO6 — CID 125122172
methyl 4-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]benzoate (PubChem CID 125122172) has the molecular formula C24H17ClO6 and a molecular weight of 436.85 g/mol. Its IUPAC name is methyl 4-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]benzoate.
| Compound Name | methyl 4-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]benzoate |
|---|---|
| PubChem CID | 125122172 |
| Molecular Formula | C24H17ClO6 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | methyl 4-[(4S)-6-(4-chlorobenzoyl)-5-hydroxy-2-oxo-3,4-dihydrochromen-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2CC(=O)Oc3ccc(C(=O)c4ccc(Cl)cc4)c(O)c32)cc1 |
| InChI | InChI=1S/C24H17ClO6/c1-30-24(29)15-4-2-13(3-5-15)18-12-20(26)31-19-11-10-17(23(28)21(18)19)22(27)14-6-8-16(25)9-7-14/h2-11,18,28H,12H2,1H3/t18-/m0/s1 |
| InChIKey | FIPZHMYULRBOHA-SFHVURJKSA-N |
| XLogP | 4.50 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|