C27H26O7 — CID 91638420
6-acetyl-5-hydroxy-4-[4-methoxy-3-[2-(4-methoxyphenyl)ethoxy]phenyl]-3,4-dihydrochromen-2-one (PubChem CID 91638420) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is 6-acetyl-5-hydroxy-4-[4-methoxy-3-[2-(4-methoxyphenyl)ethoxy]phenyl]-3,4-dihydrochromen-2-one.
| Compound Name | 6-acetyl-5-hydroxy-4-[4-methoxy-3-[2-(4-methoxyphenyl)ethoxy]phenyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 91638420 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 6-acetyl-5-hydroxy-4-[4-methoxy-3-[2-(4-methoxyphenyl)ethoxy]phenyl]-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc(CCOc2cc(C3CC(=O)Oc4ccc(C(C)=O)c(O)c43)ccc2OC)cc1 |
| InChI | InChI=1S/C27H26O7/c1-16(28)20-9-11-23-26(27(20)30)21(15-25(29)34-23)18-6-10-22(32-3)24(14-18)33-13-12-17-4-7-19(31-2)8-5-17/h4-11,14,21,30H,12-13,15H2,1-3H3 |
| InChIKey | ZLWHRJDSGHPUQU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|