C10H10O3 — CID 155904489
(3S)-3-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 155904489) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (3S)-3-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid.
| Compound Name | (3S)-3-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|---|
| PubChem CID | 155904489 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (3S)-3-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@@H](O)CC2 |
| InChI | InChI=1S/C10H10O3/c11-9-4-3-6-1-2-7(10(12)13)5-8(6)9/h1-2,5,9,11H,3-4H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | LWCVWFQTPKSGOI-VIFPVBQESA-N |
| XLogP | 1.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |