C18H16O3S — CID 70380755
14-hydroxy-2-thiatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaene-5-carboxylic acid (PubChem CID 70380755) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 14-hydroxy-2-thiatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaene-5-carboxylic acid.
| Compound Name | 14-hydroxy-2-thiatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 70380755 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 14-hydroxy-2-thiatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)Sc1cc3c(cc1CC2)C(O)CC3 |
| InChI | InChI=1S/C18H16O3S/c19-15-6-5-11-8-17-12(7-14(11)15)3-1-10-2-4-13(18(20)21)9-16(10)22-17/h2,4,7-9,15,19H,1,3,5-6H2,(H,20,21) |
| InChIKey | VWFCRUPOTXJLCV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |