C9H7NO5 — CID 57367173
2-hydroxy-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid (PubChem CID 57367173) has the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-hydroxy-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid.
| Compound Name | 2-hydroxy-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 57367173 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-hydroxy-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)OC(O)C(=O)N2 |
| InChI | InChI=1S/C9H7NO5/c11-7-9(14)15-6-3-4(8(12)13)1-2-5(6)10-7/h1-3,9,14H,(H,10,11)(H,12,13) |
| InChIKey | WNQPNUHYIDNWAM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |