C17H15NO4 — CID 142671786
3-oxo-2-(2-phenylethyl)-4H-1,4-benzoxazine-7-carboxylic acid (PubChem CID 142671786) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-oxo-2-(2-phenylethyl)-4H-1,4-benzoxazine-7-carboxylic acid.
| Compound Name | 3-oxo-2-(2-phenylethyl)-4H-1,4-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 142671786 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-oxo-2-(2-phenylethyl)-4H-1,4-benzoxazine-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)OC(CCc1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C17H15NO4/c19-16-14(9-6-11-4-2-1-3-5-11)22-15-10-12(17(20)21)7-8-13(15)18-16/h1-5,7-8,10,14H,6,9H2,(H,18,19)(H,20,21) |
| InChIKey | VOIXCTNLNQSWRL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |