C12H18N2O — CID 105459411
3-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine (PubChem CID 105459411) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine.
| Compound Name | 3-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine |
|---|---|
| PubChem CID | 105459411 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine |
| SMILES | CCNCC1COc2cc(N)ccc2C1 |
| InChI | InChI=1S/C12H18N2O/c1-2-14-7-9-5-10-3-4-11(13)6-12(10)15-8-9/h3-4,6,9,14H,2,5,7-8,13H2,1H3 |
| InChIKey | WZWZOBLWPDHQGX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|