C12H16N2O — CID 105456601
3-N-cyclopropyl-3,4-dihydro-2H-chromene-3,7-diamine (PubChem CID 105456601) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-N-cyclopropyl-3,4-dihydro-2H-chromene-3,7-diamine.
| Compound Name | 3-N-cyclopropyl-3,4-dihydro-2H-chromene-3,7-diamine |
|---|---|
| PubChem CID | 105456601 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-N-cyclopropyl-3,4-dihydro-2H-chromene-3,7-diamine |
| SMILES | Nc1ccc2c(c1)OCC(NC1CC1)C2 |
| InChI | InChI=1S/C12H16N2O/c13-9-2-1-8-5-11(14-10-3-4-10)7-15-12(8)6-9/h1-2,6,10-11,14H,3-5,7,13H2 |
| InChIKey | FTXAGDUBGCDNSD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|