C17H30N2O2 — CID 142228186
ethene;2-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine;propan-1-ol (PubChem CID 142228186) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is ethene;2-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine;propan-1-ol.
| Compound Name | ethene;2-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine;propan-1-ol |
|---|---|
| PubChem CID | 142228186 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | ethene;2-(ethylaminomethyl)-3,4-dihydro-2H-chromen-7-amine;propan-1-ol |
| SMILES | C=C.CCCO.CCNCC1CCc2ccc(N)cc2O1 |
| InChI | InChI=1S/C12H18N2O.C3H8O.C2H4/c1-2-14-8-11-6-4-9-3-5-10(13)7-12(9)15-11;1-2-3-4;1-2/h3,5,7,11,14H,2,4,6,8,13H2,1H3;4H,2-3H2,1H3;1-2H2 |
| InChIKey | ISWCRRVQYWPPNP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|