C20H26N2O3 — CID 10783507
2-[[3-(3-amino-2-methylphenoxy)propylamino]methyl]-3,4-dihydro-2H-chromen-7-ol (PubChem CID 10783507) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[[3-(3-amino-2-methylphenoxy)propylamino]methyl]-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | 2-[[3-(3-amino-2-methylphenoxy)propylamino]methyl]-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 10783507 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[[3-(3-amino-2-methylphenoxy)propylamino]methyl]-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Cc1c(N)cccc1OCCCNCC1CCc2ccc(O)cc2O1 |
| InChI | InChI=1S/C20H26N2O3/c1-14-18(21)4-2-5-19(14)24-11-3-10-22-13-17-9-7-15-6-8-16(23)12-20(15)25-17/h2,4-6,8,12,17,22-23H,3,7,9-11,13,21H2,1H3 |
| InChIKey | JMHOWYVJMKHOJR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|