C18H20FNO4S — CID 58869142
2-[[(2R)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-2-yl]methylamino]ethanol (PubChem CID 58869142) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[[(2R)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-2-yl]methylamino]ethanol.
| Compound Name | 2-[[(2R)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-2-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 58869142 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[[(2R)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromen-2-yl]methylamino]ethanol |
| SMILES | O=S(=O)(c1cccc(F)c1)c1ccc2c(c1)O[C@@H](CNCCO)CC2 |
| InChI | InChI=1S/C18H20FNO4S/c19-14-2-1-3-16(10-14)25(22,23)17-7-5-13-4-6-15(12-20-8-9-21)24-18(13)11-17/h1-3,5,7,10-11,15,20-21H,4,6,8-9,12H2/t15-/m1/s1 |
| InChIKey | ARQJVIFBNPYCIY-OAHLLOKOSA-N |
| XLogP | 1.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|