C16H17NO3S — CID 58869146
[(2R)-7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methanamine (PubChem CID 58869146) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is [(2R)-7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methanamine.
| Compound Name | [(2R)-7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methanamine |
|---|---|
| PubChem CID | 58869146 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [(2R)-7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methanamine |
| SMILES | NC[C@H]1CCc2ccc(S(=O)(=O)c3ccccc3)cc2O1 |
| InChI | InChI=1S/C16H17NO3S/c17-11-13-8-6-12-7-9-15(10-16(12)20-13)21(18,19)14-4-2-1-3-5-14/h1-5,7,9-10,13H,6,8,11,17H2/t13-/m1/s1 |
| InChIKey | YDZRLAFCRFDPGU-CYBMUJFWSA-N |
| XLogP | 2.17 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |