C19H21NO4S — CID 69089444
N-[[7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methyl]propanamide (PubChem CID 69089444) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[[7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methyl]propanamide.
| Compound Name | N-[[7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 69089444 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[[7-(benzenesulfonyl)-3,4-dihydro-2H-chromen-2-yl]methyl]propanamide |
| SMILES | CCC(=O)NCC1CCc2ccc(S(=O)(=O)c3ccccc3)cc2O1 |
| InChI | InChI=1S/C19H21NO4S/c1-2-19(21)20-13-15-10-8-14-9-11-17(12-18(14)24-15)25(22,23)16-6-4-3-5-7-16/h3-7,9,11-12,15H,2,8,10,13H2,1H3,(H,20,21) |
| InChIKey | MZAVGTBSNBCUKT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |