About (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride
(3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (PubChem CID 161082313) has the molecular formula C10H13Cl2NO
and a molecular weight of 234.13 g/mol. Its IUPAC name is (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride.
Molecular Properties
| Compound Name | (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| PubChem CID | 161082313 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| SMILES | C[C@@H]1OCc2c(Cl)cccc2[C@@H]1N.Cl |
| InChI | InChI=1S/C10H12ClNO.ClH/c1-6-10(12)7-3-2-4-9(11)8(7)5-13-6;/h2-4,6,10H,5,12H2,1H3;1H/t6-,10+;/m0./s1 |
| InChIKey | XYMSWYJHADGUPE-FXWROEHUSA-N |
| XLogP | 2.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
The IUPAC name of (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (CID 161082313) is (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride.
What is the SMILES notation for (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
The canonical SMILES for (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride is C[C@@H]1OCc2c(Cl)cccc2[C@@H]1N.Cl.
What is the InChIKey of (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
The InChIKey is XYMSWYJHADGUPE-FXWROEHUSA-N. The full InChI is InChI=1S/C10H12ClNO.ClH/c1-6-10(12)7-3-2-4-9(11)8(7)5-13-6;/h2-4,6,10H,5,12H2,1H3;1H/t6-,10+;/m0./s1.
What are the key properties of (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
(3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride has a molecular weight of 234.13 g/mol, XLogP of 2.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-8-chloro-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride is sourced from PubChem (CID 161082313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).