About (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride
(3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (PubChem CID 160629931) has the molecular formula C11H16ClNO2
and a molecular weight of 229.71 g/mol. Its IUPAC name is (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| PubChem CID | 160629931 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| SMILES | COc1cccc2c1CO[C@H](C)[C@H]2N.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-7-11(12)8-4-3-5-10(13-2)9(8)6-14-7;/h3-5,7,11H,6,12H2,1-2H3;1H/t7-,11-;/m1./s1 |
| InChIKey | ZBEQXNRIIODIEG-RGVFRNKHSA-N |
| XLogP | 2.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
The IUPAC name of (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (CID 160629931) is (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride.
What is the SMILES notation for (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
The canonical SMILES for (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride is COc1cccc2c1CO[C@H](C)[C@H]2N.Cl.
What is the InChIKey of (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
The InChIKey is ZBEQXNRIIODIEG-RGVFRNKHSA-N. The full InChI is InChI=1S/C11H15NO2.ClH/c1-7-11(12)8-4-3-5-10(13-2)9(8)6-14-7;/h3-5,7,11H,6,12H2,1-2H3;1H/t7-,11-;/m1./s1.
What are the key properties of (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride?
(3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride has a molecular weight of 229.71 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-8-methoxy-3-methyl-3,4-dihydro-1H-isochromen-4-amine;hydrochloride is sourced from PubChem (CID 160629931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).